LigandBoxID:KSH2016-00104645-01

SMILES: CCNc2nc(nc(N1CCN(S(c3cc(ccc3OC)C)(=O)=O)CC1)c2)C

2D 3D

SDF file MOL2 file

Compound ID of the source

Kishida2016
KS122-0124623

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C19H27N5O3S 405.522 0 1
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -1.1165 -8.7265
LOGS LOGP    
-3.3408 2.8849    

Links to the same SMILES compounds

ZINC ZINC65362309
PUBCHEM 50944954


[Back to top page]