LigandBoxID:KSH2017-00704098-01

SMILES: c1ccc(C2(C(N3CCN(c5ncnc4ccccc54)CC3)=O)CCOCC2)cn1

2D 3D

SDF file MOL2 file

Compound ID of the source

Kishida2017
KL-001-0944-185

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C23H25N5O2 403.486 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -0.8772 -9.3397
LOGS LOGP    
-4.873 3.212    

[Back to top page]