LigandBoxID:KSH2017-00730545-01

SMILES: Cc3nn(c2cccnc2)c(c3C(N5CC1(Cc4cccc(c54)F)CCOCC1)=O)C

2D 3D

SDF file MOL2 file

Compound ID of the source

Kishida2017
KL-001-0994-908

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C24H25N4O2F 420.488 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
4 0 -0.5269 -9.2201
LOGS LOGP    
-6.227 4.745    

[Back to top page]