LigandBoxID:KSH2017-01474388-01

SMILES: [Br]c1ccc(Cn4cnc(C(N3CCC(Oc2ccncn2)CC3)=O)c4)cc1

2D 3D

SDF file MOL2 file

Compound ID of the source

Kishida2017
KL-001-1241-234

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C20H20N5O2Br 442.317 0 0
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -0.4595 -9.2598
LOGS LOGP    
-4.578 3.026    

[Back to top page]