LigandBoxID:KSH2017-01818541-01

SMILES: Cc2ccc(C4(C(NC3(Cc1ccccn1)CCC3)=O)CC4)nc2

2D 3D

SDF file MOL2 file

Compound ID of the source

Kishida2017
KL-001-1592-531

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C20H23N3O 321.424 0 1
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
3 0 -0.0278 -9.4290
LOGS LOGP    
-5.266 4.415    

[Back to top page]