LigandBoxID:PDB_PE2

NAME:PE2;9-(4-HYDROXY-3-(HYDROXYMETHYL)BUT-1-YL)GUANINE
SMILES: OCC(CCn1cnc2C(NC(=Nc21)N)=O)CO

2D 3D

SDF file MOL2 file

Compound ID of the source

PDB_LIGAND
PE2(PDBeCHEM) PE2(ChemComp)

Calculated physical properties

MOLECULAR_FORMULA MOLECULAR_WEIGHT MOLECULAR_CHARGE NUM_OF_DONOR
C10H15N5O3 253.262 0 5
NUM_OF_ACCEPTOR NUM_OF_CHIRAL_ATOMS LUMO HOMO
5 0 -0.3235 -8.6500
LOGS LOGP    
-1.199 -1.332    

Links to the same SMILES compounds

PUBCHEM 76964038


[Back to top page]